Maltotetraose
CAS Number:34612-38-9
| Model Number:YHBT-MT-04 | Structure: ![]() |
| Chemical Name:Maltotetraose | CAS Number:34612-38-9 |
| Molecular formula:C24H42O21 | Mol. Weight:666.6 g/mol |
| Purity:HPLC≥99% | Appearance:White powder |
| Synonym: O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-D-Glucose; Amylotetraose; α-1,4-Tetraglucose _x000B__x000B_ | IUPAC Name:(2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-6-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI: 1S/C24H42O21/c25-1-6(30)11(32)19(7(31)2-26)43-23-17(38)14(35)21(9(4-28)41-23)45-24-18(39)15(36)20(10(5-29)42-24)44-22-16(37)13(34)12(33)8(3-27)40-22/h1,6-24,26-39H,2-5H2/t6-,7+,8+,9+,10+,11+,12+,13-,14+,15+,16+,17+,18+,19+,20+,21+,22+,23+,24+/m0/s1 | InChI Key: UYQJCPNSAVWAFU-KVXMBEGHSA-N |
| Isomeric SMILES:C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]4[C@H](O[C@@H]([C@@H]([C@H]4O)O)O)CO)CO)CO)O)O)O)O | SMILES: |
| Canonical SMILES:C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC(C(CO)O)C(C(C=O)O)O)CO)CO)O)O)O)O | Category:Carbohydrates |
| Solubility: | Storage condition:room temp |
| Packing: |
Application:
1. Used as a sweetener, flavoring agent, thickener, and stabilizer: improves the texture and stability of products, making them smoother and more delicate in taste; has anti-caries function; extends the shelf life of food and maintains its freshness and taste.
2. Maltotetraose can be used as an excipient in medicines to improve the stability, solubility, and taste of the drugs; it can also serve as an effective carbohydrate and energy source for enteral nutrition, suitable for people with poor digestive and absorptive functions and low nutritional status. It can also be used to study the hydrolysis patterns of various starches and to determine the activity of α-amylase in human serum and urine in medical research.
3. In cosmetics, skincare products, and other daily chemical products, maltotetraose can be used as a moisturizer.
